About N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide
N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide (PubChem CID 127614588) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide |
| PubChem CID | 127614588 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide |
| SMILES | O=C(CNCC1=CCCOC1)NC1CC1 |
| InChI | InChI=1S/C11H18N2O2/c14-11(13-10-3-4-10)7-12-6-9-2-1-5-15-8-9/h2,10,12H,1,3-8H2,(H,13,14) |
| InChIKey | UGODQRAWORZCRT-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide?
The IUPAC name of N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide (CID 127614588) is N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide.
What is the SMILES notation for N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide?
The canonical SMILES for N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide is O=C(CNCC1=CCCOC1)NC1CC1.
What is the InChIKey of N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide?
The InChIKey is UGODQRAWORZCRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c14-11(13-10-3-4-10)7-12-6-9-2-1-5-15-8-9/h2,10,12H,1,3-8H2,(H,13,14).
What are the key properties of N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide?
N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide has a molecular weight of 210.28 g/mol, XLogP of 0.20, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-(3,6-dihydro-2H-pyran-5-ylmethylamino)acetamide is sourced from PubChem (CID 127614588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).