About 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride (PubChem CID 12761781) has the molecular formula C16H15ClN2O2
and a molecular weight of 302.76 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride.
Molecular Properties
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride |
| PubChem CID | 12761781 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)OCC(Cc1nc3ccccc3[nH]1)O2 |
| InChI | InChI=1S/C16H14N2O2.ClH/c1-2-6-13-12(5-1)17-16(18-13)9-11-10-19-14-7-3-4-8-15(14)20-11;/h1-8,11H,9-10H2,(H,17,18);1H |
| InChIKey | FBRFFRNLIKFHGC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride (CID 12761781) is 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride is Cl.c1ccc2c(c1)OCC(Cc1nc3ccccc3[nH]1)O2.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride?
The InChIKey is FBRFFRNLIKFHGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O2.ClH/c1-2-6-13-12(5-1)17-16(18-13)9-11-10-19-14-7-3-4-8-15(14)20-11;/h1-8,11H,9-10H2,(H,17,18);1H.
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride?
2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride has a molecular weight of 302.76 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxin-3-ylmethyl)-1H-benzimidazole;hydrochloride is sourced from PubChem (CID 12761781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).