C14H19IN2OS — CID 12761834
4-tert-butyl-2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-6-iodophenol (PubChem CID 12761834) has the molecular formula C14H19IN2OS and a molecular weight of 390.29 g/mol. Its IUPAC name is 4-tert-butyl-2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-6-iodophenol.
| Compound Name | 4-tert-butyl-2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-6-iodophenol |
|---|---|
| PubChem CID | 12761834 |
| Molecular Formula | C14H19IN2OS |
| Molecular Weight | 390.29 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 4-tert-butyl-2-[(4,5-dihydro-1,3-thiazol-2-ylamino)methyl]-6-iodophenol |
| SMILES | CC(C)(C)c1cc(I)c(O)c(CNC2=NCCS2)c1 |
| InChI | InChI=1S/C14H19IN2OS/c1-14(2,3)10-6-9(12(18)11(15)7-10)8-17-13-16-4-5-19-13/h6-7,18H,4-5,8H2,1-3H3,(H,16,17) |
| InChIKey | GOYMYZRRBAQDNP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|