C11H14INO3S — CID 12761842
6-tert-butyl-8-iodo-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide (PubChem CID 12761842) has the molecular formula C11H14INO3S and a molecular weight of 367.21 g/mol. Its IUPAC name is 6-tert-butyl-8-iodo-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide.
| Compound Name | 6-tert-butyl-8-iodo-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 12761842 |
| Molecular Formula | C11H14INO3S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 6-tert-butyl-8-iodo-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
| SMILES | CC(C)(C)c1cc(I)c2c(c1)CNS(=O)(=O)O2 |
| InChI | InChI=1S/C11H14INO3S/c1-11(2,3)8-4-7-6-13-17(14,15)16-10(7)9(12)5-8/h4-5,13H,6H2,1-3H3 |
| InChIKey | LYCCHNUYSMCVNL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|