C18H20ClN3O5 — CID 127622849
1-(5-chloro-2-methoxybenzoyl)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide (PubChem CID 127622849) has the molecular formula C18H20ClN3O5 and a molecular weight of 393.83 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxybenzoyl)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(5-chloro-2-methoxybenzoyl)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 127622849 |
| Molecular Formula | C18H20ClN3O5 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-(5-chloro-2-methoxybenzoyl)-N-(2,6-dioxopiperidin-3-yl)pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCCC1C(=O)NC1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H20ClN3O5/c1-27-14-6-4-10(19)9-11(14)18(26)22-8-2-3-13(22)17(25)20-12-5-7-15(23)21-16(12)24/h4,6,9,12-13H,2-3,5,7-8H2,1H3,(H,20,25)(H,21,23,24) |
| InChIKey | ZBTGLVVYSKCQLE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|