About 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine
1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine (PubChem CID 12762326) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine.
Molecular Properties
| Compound Name | 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine |
| PubChem CID | 12762326 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine |
| SMILES | CC1=NCCCN1C1CCCCC1 |
| InChI | InChI=1S/C11H20N2/c1-10-12-8-5-9-13(10)11-6-3-2-4-7-11/h11H,2-9H2,1H3 |
| InChIKey | FKYONBISVHBUKK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine?
The IUPAC name of 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine (CID 12762326) is 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine.
What is the SMILES notation for 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine?
The canonical SMILES for 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine is CC1=NCCCN1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine?
The InChIKey is FKYONBISVHBUKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2/c1-10-12-8-5-9-13(10)11-6-3-2-4-7-11/h11H,2-9H2,1H3.
What are the key properties of 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine?
1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine has a molecular weight of 180.29 g/mol, XLogP of 2.44, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-2-methyl-5,6-dihydro-4H-pyrimidine is sourced from PubChem (CID 12762326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).