C22H27N5O — CID 127623587
1-cyclopropyl-N-(2-phenylpyrimidin-5-yl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide (PubChem CID 127623587) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-cyclopropyl-N-(2-phenylpyrimidin-5-yl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide.
| Compound Name | 1-cyclopropyl-N-(2-phenylpyrimidin-5-yl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 127623587 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-cyclopropyl-N-(2-phenylpyrimidin-5-yl)-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
| SMILES | O=C(Nc1cnc(-c2ccccc2)nc1)N1CCC2C(CCCN2C2CC2)C1 |
| InChI | InChI=1S/C22H27N5O/c28-22(25-18-13-23-21(24-14-18)16-5-2-1-3-6-16)26-12-10-20-17(15-26)7-4-11-27(20)19-8-9-19/h1-3,5-6,13-14,17,19-20H,4,7-12,15H2,(H,25,28) |
| InChIKey | LDNWCCLNKYTKMA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |