About N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine
N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine (PubChem CID 12762816) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine |
| PubChem CID | 12762816 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)NC[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C9H19NO2/c1-7(2)10-5-8-6-11-9(3,4)12-8/h7-8,10H,5-6H2,1-4H3/t8-/m0/s1 |
| InChIKey | CLPYLBMXTAOERP-QMMMGPOBSA-N |
| XLogP | 1.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine?
The IUPAC name of N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine (CID 12762816) is N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine.
What is the SMILES notation for N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine?
The canonical SMILES for N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine is CC(C)NC[C@H]1COC(C)(C)O1.
What is the InChIKey of N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine?
The InChIKey is CLPYLBMXTAOERP-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H19NO2/c1-7(2)10-5-8-6-11-9(3,4)12-8/h7-8,10H,5-6H2,1-4H3/t8-/m0/s1.
What are the key properties of N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine?
N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine has a molecular weight of 173.26 g/mol, XLogP of 1.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]propan-2-amine is sourced from PubChem (CID 12762816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).