About propan-2-ylcyclohexane
propan-2-ylcyclohexane (PubChem CID 12763) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is propan-2-ylcyclohexane.
Molecular Properties
| Compound Name | propan-2-ylcyclohexane |
| PubChem CID | 12763 |
| Molecular Formula | C9H18 |
| Molecular Weight | 126.24 g/mol |
| Exact Mass | 126.14 |
| IUPAC Name | propan-2-ylcyclohexane |
| SMILES | CC(C)C1CCCCC1 |
| InChI | InChI=1S/C9H18/c1-8(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | GWESVXSMPKAFAS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.24 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze propan-2-ylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-ylcyclohexane?
The IUPAC name of propan-2-ylcyclohexane (CID 12763) is propan-2-ylcyclohexane.
What is the SMILES notation for propan-2-ylcyclohexane?
The canonical SMILES for propan-2-ylcyclohexane is CC(C)C1CCCCC1.
What is the InChIKey of propan-2-ylcyclohexane?
The InChIKey is GWESVXSMPKAFAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18/c1-8(2)9-6-4-3-5-7-9/h8-9H,3-7H2,1-2H3.
What are the key properties of propan-2-ylcyclohexane?
propan-2-ylcyclohexane has a molecular weight of 126.24 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-ylcyclohexane is sourced from PubChem (CID 12763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).