About 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine
2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine (PubChem CID 12763826) has the molecular formula C13H14ClN5
and a molecular weight of 275.74 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine |
| PubChem CID | 12763826 |
| Molecular Formula | C13H14ClN5 |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine |
| SMILES | Cc1cc(NC2=NCCN2)n(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C13H14ClN5/c1-9-7-12(17-13-15-5-6-16-13)19(18-9)11-4-2-3-10(14)8-11/h2-4,7-8H,5-6H2,1H3,(H2,15,16,17) |
| InChIKey | AWUFTMODMFQLAT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine?
The IUPAC name of 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine (CID 12763826) is 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine.
What is the SMILES notation for 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine?
The canonical SMILES for 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine is Cc1cc(NC2=NCCN2)n(-c2cccc(Cl)c2)n1.
What is the InChIKey of 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine?
The InChIKey is AWUFTMODMFQLAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN5/c1-9-7-12(17-13-15-5-6-16-13)19(18-9)11-4-2-3-10(14)8-11/h2-4,7-8H,5-6H2,1H3,(H2,15,16,17).
What are the key properties of 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine?
2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine has a molecular weight of 275.74 g/mol, XLogP of 2.21, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-N-(4,5-dihydro-1H-imidazol-2-yl)-5-methylpyrazol-3-amine is sourced from PubChem (CID 12763826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).