About 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine
4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine (PubChem CID 12763845) has the molecular formula C7H10ClN5
and a molecular weight of 199.65 g/mol. Its IUPAC name is 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine.
Molecular Properties
| Compound Name | 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine |
| PubChem CID | 12763845 |
| Molecular Formula | C7H10ClN5 |
| Molecular Weight | 199.65 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine |
| SMILES | Cn1ncc(Cl)c1NC1=NCCN1 |
| InChI | InChI=1S/C7H10ClN5/c1-13-6(5(8)4-11-13)12-7-9-2-3-10-7/h4H,2-3H2,1H3,(H2,9,10,12) |
| InChIKey | WUJRXORNIWPSHR-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.65 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine?
The IUPAC name of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine (CID 12763845) is 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine.
What is the SMILES notation for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine?
The canonical SMILES for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine is Cn1ncc(Cl)c1NC1=NCCN1.
What is the InChIKey of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine?
The InChIKey is WUJRXORNIWPSHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN5/c1-13-6(5(8)4-11-13)12-7-9-2-3-10-7/h4H,2-3H2,1H3,(H2,9,10,12).
What are the key properties of 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine?
4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine has a molecular weight of 199.65 g/mol, XLogP of 0.44, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(4,5-dihydro-1H-imidazol-2-yl)-1-methylpyrazol-5-amine is sourced from PubChem (CID 12763845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).