About imidazo[1,2-a]quinoline-2-carboxylic acid
imidazo[1,2-a]quinoline-2-carboxylic acid (PubChem CID 12763992) has the molecular formula C12H8N2O2
and a molecular weight of 212.21 g/mol. Its IUPAC name is imidazo[1,2-a]quinoline-2-carboxylic acid.
Molecular Properties
| Compound Name | imidazo[1,2-a]quinoline-2-carboxylic acid |
| PubChem CID | 12763992 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | imidazo[1,2-a]quinoline-2-carboxylic acid |
| SMILES | O=C(O)c1cn2c(ccc3ccccc32)n1 |
| InChI | InChI=1S/C12H8N2O2/c15-12(16)9-7-14-10-4-2-1-3-8(10)5-6-11(14)13-9/h1-7H,(H,15,16) |
| InChIKey | VUEWYMPSGWCXLN-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze imidazo[1,2-a]quinoline-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,2-a]quinoline-2-carboxylic acid?
The IUPAC name of imidazo[1,2-a]quinoline-2-carboxylic acid (CID 12763992) is imidazo[1,2-a]quinoline-2-carboxylic acid.
What is the SMILES notation for imidazo[1,2-a]quinoline-2-carboxylic acid?
The canonical SMILES for imidazo[1,2-a]quinoline-2-carboxylic acid is O=C(O)c1cn2c(ccc3ccccc32)n1.
What is the InChIKey of imidazo[1,2-a]quinoline-2-carboxylic acid?
The InChIKey is VUEWYMPSGWCXLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O2/c15-12(16)9-7-14-10-4-2-1-3-8(10)5-6-11(14)13-9/h1-7H,(H,15,16).
What are the key properties of imidazo[1,2-a]quinoline-2-carboxylic acid?
imidazo[1,2-a]quinoline-2-carboxylic acid has a molecular weight of 212.21 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,2-a]quinoline-2-carboxylic acid is sourced from PubChem (CID 12763992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).