C17H26N4O — CID 127643910
2-(2-bicyclo[2.2.1]heptanyl)-1-[3-(triazol-1-ylmethyl)piperidin-1-yl]ethanone (PubChem CID 127643910) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-1-[3-(triazol-1-ylmethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[3-(triazol-1-ylmethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 127643910 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-1-[3-(triazol-1-ylmethyl)piperidin-1-yl]ethanone |
| SMILES | O=C(CC1CC2CCC1C2)N1CCCC(Cn2ccnn2)C1 |
| InChI | InChI=1S/C17H26N4O/c22-17(10-16-9-13-3-4-15(16)8-13)20-6-1-2-14(11-20)12-21-7-5-18-19-21/h5,7,13-16H,1-4,6,8-12H2 |
| InChIKey | QICOJPSVMXXNOS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |