About 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole
2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole (PubChem CID 12764851) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole.
Molecular Properties
| Compound Name | 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole |
| PubChem CID | 12764851 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole |
| SMILES | CCOC1=NC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C13H17NO/c1-2-15-13-9-8-12(14-13)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3 |
| InChIKey | WOXMKKYYJZIPKM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole?
The IUPAC name of 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole (CID 12764851) is 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole.
What is the SMILES notation for 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole?
The canonical SMILES for 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole is CCOC1=NC(Cc2ccccc2)CC1.
What is the InChIKey of 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole?
The InChIKey is WOXMKKYYJZIPKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-2-15-13-9-8-12(14-13)10-11-6-4-3-5-7-11/h3-7,12H,2,8-10H2,1H3.
What are the key properties of 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole?
2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole has a molecular weight of 203.28 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-ethoxy-3,4-dihydro-2H-pyrrole is sourced from PubChem (CID 12764851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).