About 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole
5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (PubChem CID 12764882) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
Molecular Properties
| Compound Name | 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| PubChem CID | 12764882 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole |
| SMILES | c1ccc(CC2CCc3nccn32)cc1 |
| InChI | InChI=1S/C13H14N2/c1-2-4-11(5-3-1)10-12-6-7-13-14-8-9-15(12)13/h1-5,8-9,12H,6-7,10H2 |
| InChIKey | XGVFTELWPKVMFK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The IUPAC name of 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole (CID 12764882) is 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole.
What is the SMILES notation for 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The canonical SMILES for 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is c1ccc(CC2CCc3nccn32)cc1.
What is the InChIKey of 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
The InChIKey is XGVFTELWPKVMFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2/c1-2-4-11(5-3-1)10-12-6-7-13-14-8-9-15(12)13/h1-5,8-9,12H,6-7,10H2.
What are the key properties of 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole?
5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole has a molecular weight of 198.27 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazole is sourced from PubChem (CID 12764882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).