About 2-(3-nitro-1,2,4-triazol-1-yl)acetamide
2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 1276712) has the molecular formula C4H5N5O3
and a molecular weight of 171.12 g/mol. Its IUPAC name is 2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| PubChem CID | 1276712 |
| Molecular Formula | C4H5N5O3 |
| Molecular Weight | 171.12 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | NC(=O)Cn1cnc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C4H5N5O3/c5-3(10)1-8-2-6-4(7-8)9(11)12/h2H,1H2,(H2,5,10) |
| InChIKey | LSLXQACWPYRWKG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.12 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitro-1,2,4-triazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The IUPAC name of 2-(3-nitro-1,2,4-triazol-1-yl)acetamide (CID 1276712) is 2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
What is the SMILES notation for 2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The canonical SMILES for 2-(3-nitro-1,2,4-triazol-1-yl)acetamide is NC(=O)Cn1cnc([N+](=O)[O-])n1.
What is the InChIKey of 2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
The InChIKey is LSLXQACWPYRWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N5O3/c5-3(10)1-8-2-6-4(7-8)9(11)12/h2H,1H2,(H2,5,10).
What are the key properties of 2-(3-nitro-1,2,4-triazol-1-yl)acetamide?
2-(3-nitro-1,2,4-triazol-1-yl)acetamide has a molecular weight of 171.12 g/mol, XLogP of -1.33, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitro-1,2,4-triazol-1-yl)acetamide is sourced from PubChem (CID 1276712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).