About 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline
8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline (PubChem CID 1276764) has the molecular formula C12H11N3O
and a molecular weight of 213.24 g/mol. Its IUPAC name is 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline.
Molecular Properties
| Compound Name | 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline |
| PubChem CID | 1276764 |
| Molecular Formula | C12H11N3O |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline |
| SMILES | COc1ccc2c(C)cc3nncn3c2c1 |
| InChI | InChI=1S/C12H11N3O/c1-8-5-12-14-13-7-15(12)11-6-9(16-2)3-4-10(8)11/h3-7H,1-2H3 |
| InChIKey | ABXPLSSVXWMCDS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The IUPAC name of 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline (CID 1276764) is 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline.
What is the SMILES notation for 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The canonical SMILES for 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline is COc1ccc2c(C)cc3nncn3c2c1.
What is the InChIKey of 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
The InChIKey is ABXPLSSVXWMCDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O/c1-8-5-12-14-13-7-15(12)11-6-9(16-2)3-4-10(8)11/h3-7H,1-2H3.
What are the key properties of 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline?
8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline has a molecular weight of 213.24 g/mol, XLogP of 2.20, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxy-5-methyl-[1,2,4]triazolo[4,3-a]quinoline is sourced from PubChem (CID 1276764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).