C19H20N2O3 — CID 127677869
1-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-3-methyl-3-(4-methylphenyl)pyrrolidine-2,5-dione (PubChem CID 127677869) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-3-methyl-3-(4-methylphenyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-3-methyl-3-(4-methylphenyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 127677869 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[(5-cyclopropyl-1,3-oxazol-2-yl)methyl]-3-methyl-3-(4-methylphenyl)pyrrolidine-2,5-dione |
| SMILES | Cc1ccc(C2(C)CC(=O)N(Cc3ncc(C4CC4)o3)C2=O)cc1 |
| InChI | InChI=1S/C19H20N2O3/c1-12-3-7-14(8-4-12)19(2)9-17(22)21(18(19)23)11-16-20-10-15(24-16)13-5-6-13/h3-4,7-8,10,13H,5-6,9,11H2,1-2H3 |
| InChIKey | AJNXIDCBOWTTJV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|