C10H7Cl7 — CID 12767891
(1R,2R,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 12767891) has the molecular formula C10H7Cl7 and a molecular weight of 375.34 g/mol. Its IUPAC name is (1R,2R,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | (1R,2R,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 12767891 |
| Molecular Formula | C10H7Cl7 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 371.84 |
| IUPAC Name | (1R,2R,6S,7S)-1,4,7,8,9,10,10-heptachlorotricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | ClC1=C(Cl)[C@]2(Cl)[C@@H]3CC(Cl)C[C@@H]3[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C10H7Cl7/c11-3-1-4-5(2-3)9(15)7(13)6(12)8(4,14)10(9,16)17/h3-5H,1-2H2/t3?,4-,5+,8-,9+ |
| InChIKey | CLTVIMPCWMHKFX-QTXMIJDDSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|