About (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one
(Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one (PubChem CID 12769457) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one.
Molecular Properties
| Compound Name | (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one |
| PubChem CID | 12769457 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one |
| SMILES | C/C=C(/C(=O)C(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C11H16N2O/c1-5-9(10(14)11(2,3)4)13-7-6-12-8-13/h5-8H,1-4H3/b9-5- |
| InChIKey | JUIAKSZZKZYVHQ-UITAMQMPSA-N |
| XLogP | 2.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one?
The IUPAC name of (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one (CID 12769457) is (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one.
What is the SMILES notation for (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one?
The canonical SMILES for (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one is C/C=C(/C(=O)C(C)(C)C)n1ccnc1.
What is the InChIKey of (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one?
The InChIKey is JUIAKSZZKZYVHQ-UITAMQMPSA-N. The full InChI is InChI=1S/C11H16N2O/c1-5-9(10(14)11(2,3)4)13-7-6-12-8-13/h5-8H,1-4H3/b9-5-.
What are the key properties of (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one?
(Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one has a molecular weight of 192.26 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-imidazol-1-yl-2,2-dimethylhex-4-en-3-one is sourced from PubChem (CID 12769457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).