C14H24N2O — CID 12769484
(Z)-4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-ol (PubChem CID 12769484) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (Z)-4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-ol.
| Compound Name | (Z)-4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-ol |
|---|---|
| PubChem CID | 12769484 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (Z)-4-imidazol-1-yl-2,2,6,6-tetramethylhept-4-en-3-ol |
| SMILES | CC(C)(C)/C=C(/C(O)C(C)(C)C)n1ccnc1 |
| InChI | InChI=1S/C14H24N2O/c1-13(2,3)9-11(12(17)14(4,5)6)16-8-7-15-10-16/h7-10,12,17H,1-6H3/b11-9- |
| InChIKey | CDHAATSYJHEHKE-LUAWRHEFSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |