About 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide
6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide (PubChem CID 127698679) has the molecular formula C14H16ClN3O2S
and a molecular weight of 325.82 g/mol. Its IUPAC name is 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide.
Molecular Properties
| Compound Name | 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide |
| PubChem CID | 127698679 |
| Molecular Formula | C14H16ClN3O2S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide |
| SMILES | CC(C)n1ccc(CN2c3cc(Cl)ccc3CS2(=O)=O)n1 |
| InChI | InChI=1S/C14H16ClN3O2S/c1-10(2)17-6-5-13(16-17)8-18-14-7-12(15)4-3-11(14)9-21(18,19)20/h3-7,10H,8-9H2,1-2H3 |
| InChIKey | GNVIINJILAEBSX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide?
The IUPAC name of 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide (CID 127698679) is 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide.
What is the SMILES notation for 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide?
The canonical SMILES for 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide is CC(C)n1ccc(CN2c3cc(Cl)ccc3CS2(=O)=O)n1.
What is the InChIKey of 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide?
The InChIKey is GNVIINJILAEBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3O2S/c1-10(2)17-6-5-13(16-17)8-18-14-7-12(15)4-3-11(14)9-21(18,19)20/h3-7,10H,8-9H2,1-2H3.
What are the key properties of 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide?
6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide has a molecular weight of 325.82 g/mol, XLogP of 2.97, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-[(1-propan-2-ylpyrazol-3-yl)methyl]-3H-2,1-benzothiazole 2,2-dioxide is sourced from PubChem (CID 127698679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).