About chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane
chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane (PubChem CID 12769888) has the molecular formula C6H6Cl5O2P
and a molecular weight of 318.35 g/mol. Its IUPAC name is chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane.
Molecular Properties
| Compound Name | chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane |
| PubChem CID | 12769888 |
| Molecular Formula | C6H6Cl5O2P |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 315.85 |
| IUPAC Name | chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane |
| SMILES | CC(OP(Cl)OC(C)=C(Cl)Cl)=C(Cl)Cl |
| InChI | InChI=1S/C6H6Cl5O2P/c1-3(5(7)8)12-14(11)13-4(2)6(9)10/h1-2H3 |
| InChIKey | GZDBGKZRNWXHML-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane?
The IUPAC name of chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane (CID 12769888) is chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane.
What is the SMILES notation for chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane?
The canonical SMILES for chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane is CC(OP(Cl)OC(C)=C(Cl)Cl)=C(Cl)Cl.
What is the InChIKey of chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane?
The InChIKey is GZDBGKZRNWXHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6Cl5O2P/c1-3(5(7)8)12-14(11)13-4(2)6(9)10/h1-2H3.
What are the key properties of chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane?
chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane has a molecular weight of 318.35 g/mol, XLogP of 5.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-bis(1,1-dichloroprop-1-en-2-yloxy)phosphane is sourced from PubChem (CID 12769888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).