About 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride
3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride (PubChem CID 12770552) has the molecular formula C22H34Cl2N2O2
and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride.
Molecular Properties
| Compound Name | 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride |
| PubChem CID | 12770552 |
| Molecular Formula | C22H34Cl2N2O2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride |
| SMILES | CCCCNC(c1cccc(O)c1)C(NCCCC)c1cccc(O)c1.Cl.Cl |
| InChI | InChI=1S/C22H32N2O2.2ClH/c1-3-5-13-23-21(17-9-7-11-19(25)15-17)22(24-14-6-4-2)18-10-8-12-20(26)16-18;;/h7-12,15-16,21-26H,3-6,13-14H2,1-2H3;2*1H |
| InChIKey | WDZQDLLGQLJLJF-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride?
The IUPAC name of 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride (CID 12770552) is 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride.
What is the SMILES notation for 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride?
The canonical SMILES for 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride is CCCCNC(c1cccc(O)c1)C(NCCCC)c1cccc(O)c1.Cl.Cl.
What is the InChIKey of 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride?
The InChIKey is WDZQDLLGQLJLJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32N2O2.2ClH/c1-3-5-13-23-21(17-9-7-11-19(25)15-17)22(24-14-6-4-2)18-10-8-12-20(26)16-18;;/h7-12,15-16,21-26H,3-6,13-14H2,1-2H3;2*1H.
What are the key properties of 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride?
3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride has a molecular weight of 429.43 g/mol, XLogP of 5.50, 11 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,2-bis(butylamino)-2-(3-hydroxyphenyl)ethyl]phenol;dihydrochloride is sourced from PubChem (CID 12770552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).