About decyl 3-aminopropanoate
decyl 3-aminopropanoate (PubChem CID 12771378) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is decyl 3-aminopropanoate.
Molecular Properties
| Compound Name | decyl 3-aminopropanoate |
| PubChem CID | 12771378 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | decyl 3-aminopropanoate |
| SMILES | CCCCCCCCCCOC(=O)CCN |
| InChI | InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-12-16-13(15)10-11-14/h2-12,14H2,1H3 |
| InChIKey | XXVIUOKZSWGIOP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decyl 3-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decyl 3-aminopropanoate?
The IUPAC name of decyl 3-aminopropanoate (CID 12771378) is decyl 3-aminopropanoate.
What is the SMILES notation for decyl 3-aminopropanoate?
The canonical SMILES for decyl 3-aminopropanoate is CCCCCCCCCCOC(=O)CCN.
What is the InChIKey of decyl 3-aminopropanoate?
The InChIKey is XXVIUOKZSWGIOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-12-16-13(15)10-11-14/h2-12,14H2,1H3.
What are the key properties of decyl 3-aminopropanoate?
decyl 3-aminopropanoate has a molecular weight of 229.36 g/mol, XLogP of 3.02, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decyl 3-aminopropanoate is sourced from PubChem (CID 12771378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).