C12H22O2Si — CID 12771833
(1S,2R,6R)-2-ethenyl-6-methyl-3-trimethylsilyloxycyclohex-3-en-1-ol (PubChem CID 12771833) has the molecular formula C12H22O2Si and a molecular weight of 226.39 g/mol. Its IUPAC name is (1S,2R,6R)-2-ethenyl-6-methyl-3-trimethylsilyloxycyclohex-3-en-1-ol.
| Compound Name | (1S,2R,6R)-2-ethenyl-6-methyl-3-trimethylsilyloxycyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 12771833 |
| Molecular Formula | C12H22O2Si |
| Molecular Weight | 226.39 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (1S,2R,6R)-2-ethenyl-6-methyl-3-trimethylsilyloxycyclohex-3-en-1-ol |
| SMILES | C=C[C@H]1C(O[Si](C)(C)C)=CC[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C12H22O2Si/c1-6-10-11(14-15(3,4)5)8-7-9(2)12(10)13/h6,8-10,12-13H,1,7H2,2-5H3/t9-,10+,12+/m1/s1 |
| InChIKey | ZUSRUXZGZWVLFO-SCVCMEIPSA-N |
| XLogP | 2.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|