C27H26N2O2 — CID 12772107
[2-[(Z)-N-isocyanato-C-(2,4,6-trimethylphenyl)carbonimidoyl]phenyl]-(2,4,6-trimethylphenyl)methanone (PubChem CID 12772107) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is [2-[(Z)-N-isocyanato-C-(2,4,6-trimethylphenyl)carbonimidoyl]phenyl]-(2,4,6-trimethylphenyl)methanone.
| Compound Name | [2-[(Z)-N-isocyanato-C-(2,4,6-trimethylphenyl)carbonimidoyl]phenyl]-(2,4,6-trimethylphenyl)methanone |
|---|---|
| PubChem CID | 12772107 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | [2-[(Z)-N-isocyanato-C-(2,4,6-trimethylphenyl)carbonimidoyl]phenyl]-(2,4,6-trimethylphenyl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2/C(=N/N=C=O)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C27H26N2O2/c1-16-11-18(3)24(19(4)12-16)26(29-28-15-30)22-9-7-8-10-23(22)27(31)25-20(5)13-17(2)14-21(25)6/h7-14H,1-6H3/b29-26- |
| InChIKey | JDONMGNVLFXVRN-WCTVFOPTSA-N |
| XLogP | 5.86 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|