C18H24N4O2 — CID 127724371
2-cycloheptyloxy-N-(4-phenyl-1,2,4-triazol-3-yl)propanamide (PubChem CID 127724371) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 2-cycloheptyloxy-N-(4-phenyl-1,2,4-triazol-3-yl)propanamide.
| Compound Name | 2-cycloheptyloxy-N-(4-phenyl-1,2,4-triazol-3-yl)propanamide |
|---|---|
| PubChem CID | 127724371 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 2-cycloheptyloxy-N-(4-phenyl-1,2,4-triazol-3-yl)propanamide |
| SMILES | CC(OC1CCCCCC1)C(=O)Nc1nncn1-c1ccccc1 |
| InChI | InChI=1S/C18H24N4O2/c1-14(24-16-11-7-2-3-8-12-16)17(23)20-18-21-19-13-22(18)15-9-5-4-6-10-15/h4-6,9-10,13-14,16H,2-3,7-8,11-12H2,1H3,(H,20,21,23) |
| InChIKey | BWUOIKANNLEMNU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |