C16H24N4O — CID 127727149
1-spiro[2.5]octan-2-yl-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea (PubChem CID 127727149) has the molecular formula C16H24N4O and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-spiro[2.5]octan-2-yl-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea.
| Compound Name | 1-spiro[2.5]octan-2-yl-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
|---|---|
| PubChem CID | 127727149 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 1-spiro[2.5]octan-2-yl-3-(4,5,6,7-tetrahydro-1H-indazol-7-yl)urea |
| SMILES | O=C(NC1CCCc2cn[nH]c21)NC1CC12CCCCC2 |
| InChI | InChI=1S/C16H24N4O/c21-15(19-13-9-16(13)7-2-1-3-8-16)18-12-6-4-5-11-10-17-20-14(11)12/h10,12-13H,1-9H2,(H,17,20)(H2,18,19,21) |
| InChIKey | AJVKOEHZAVAZJL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |