About 9-prop-2-enoxyfuro[3,2-g]chromen-7-one
9-prop-2-enoxyfuro[3,2-g]chromen-7-one (PubChem CID 12772891) has the molecular formula C14H10O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is 9-prop-2-enoxyfuro[3,2-g]chromen-7-one.
Molecular Properties
| Compound Name | 9-prop-2-enoxyfuro[3,2-g]chromen-7-one |
| PubChem CID | 12772891 |
| Molecular Formula | C14H10O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 9-prop-2-enoxyfuro[3,2-g]chromen-7-one |
| SMILES | C=CCOc1c2occc2cc2ccc(=O)oc12 |
| InChI | InChI=1S/C14H10O4/c1-2-6-16-14-12-10(5-7-17-12)8-9-3-4-11(15)18-13(9)14/h2-5,7-8H,1,6H2 |
| InChIKey | NSKDBUBAOLSDRF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-prop-2-enoxyfuro[3,2-g]chromen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-prop-2-enoxyfuro[3,2-g]chromen-7-one?
The IUPAC name of 9-prop-2-enoxyfuro[3,2-g]chromen-7-one (CID 12772891) is 9-prop-2-enoxyfuro[3,2-g]chromen-7-one.
What is the SMILES notation for 9-prop-2-enoxyfuro[3,2-g]chromen-7-one?
The canonical SMILES for 9-prop-2-enoxyfuro[3,2-g]chromen-7-one is C=CCOc1c2occc2cc2ccc(=O)oc12.
What is the InChIKey of 9-prop-2-enoxyfuro[3,2-g]chromen-7-one?
The InChIKey is NSKDBUBAOLSDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10O4/c1-2-6-16-14-12-10(5-7-17-12)8-9-3-4-11(15)18-13(9)14/h2-5,7-8H,1,6H2.
What are the key properties of 9-prop-2-enoxyfuro[3,2-g]chromen-7-one?
9-prop-2-enoxyfuro[3,2-g]chromen-7-one has a molecular weight of 242.23 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-prop-2-enoxyfuro[3,2-g]chromen-7-one is sourced from PubChem (CID 12772891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).