About 1-butan-2-ylpyrrolidine
1-butan-2-ylpyrrolidine (PubChem CID 12773423) has the molecular formula C8H17N
and a molecular weight of 127.23 g/mol. Its IUPAC name is 1-butan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | 1-butan-2-ylpyrrolidine |
| PubChem CID | 12773423 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 1-butan-2-ylpyrrolidine |
| SMILES | CCC(C)N1CCCC1 |
| InChI | InChI=1S/C8H17N/c1-3-8(2)9-6-4-5-7-9/h8H,3-7H2,1-2H3 |
| InChIKey | YSOZFXKDKRMJNG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-butan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-ylpyrrolidine?
The IUPAC name of 1-butan-2-ylpyrrolidine (CID 12773423) is 1-butan-2-ylpyrrolidine.
What is the SMILES notation for 1-butan-2-ylpyrrolidine?
The canonical SMILES for 1-butan-2-ylpyrrolidine is CCC(C)N1CCCC1.
What is the InChIKey of 1-butan-2-ylpyrrolidine?
The InChIKey is YSOZFXKDKRMJNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N/c1-3-8(2)9-6-4-5-7-9/h8H,3-7H2,1-2H3.
What are the key properties of 1-butan-2-ylpyrrolidine?
1-butan-2-ylpyrrolidine has a molecular weight of 127.23 g/mol, XLogP of 1.88, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-ylpyrrolidine is sourced from PubChem (CID 12773423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).