About 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate
3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate (PubChem CID 12773582) has the molecular formula C11H13N3O2
and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate.
Molecular Properties
| Compound Name | 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate |
| PubChem CID | 12773582 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate |
| SMILES | CC(=O)OCCCc1cnc2ccnn2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-9(15)16-6-2-3-10-7-12-11-4-5-13-14(11)8-10/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | PAAISYTYPANBKN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate?
The IUPAC name of 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate (CID 12773582) is 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate.
What is the SMILES notation for 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate?
The canonical SMILES for 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate is CC(=O)OCCCc1cnc2ccnn2c1.
What is the InChIKey of 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate?
The InChIKey is PAAISYTYPANBKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O2/c1-9(15)16-6-2-3-10-7-12-11-4-5-13-14(11)8-10/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate?
3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate has a molecular weight of 219.24 g/mol, XLogP of 1.23, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazolo[1,5-a]pyrimidin-6-ylpropyl acetate is sourced from PubChem (CID 12773582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).