About 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate
3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate (PubChem CID 12773584) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate.
Molecular Properties
| Compound Name | 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate |
| PubChem CID | 12773584 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate |
| SMILES | CC(=O)OCCCc1cnc2cc(C)nn2c1 |
| InChI | InChI=1S/C12H15N3O2/c1-9-6-12-13-7-11(8-15(12)14-9)4-3-5-17-10(2)16/h6-8H,3-5H2,1-2H3 |
| InChIKey | OYQNGLULQNNTSI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate?
The IUPAC name of 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate (CID 12773584) is 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate.
What is the SMILES notation for 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate?
The canonical SMILES for 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate is CC(=O)OCCCc1cnc2cc(C)nn2c1.
What is the InChIKey of 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate?
The InChIKey is OYQNGLULQNNTSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-9-6-12-13-7-11(8-15(12)14-9)4-3-5-17-10(2)16/h6-8H,3-5H2,1-2H3.
What are the key properties of 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate?
3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate has a molecular weight of 233.27 g/mol, XLogP of 1.53, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpyrazolo[1,5-a]pyrimidin-6-yl)propyl acetate is sourced from PubChem (CID 12773584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).