C26H48O4Si — CID 12773789
methyl (5Z,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxyheptadeca-5,10-dienoate (PubChem CID 12773789) has the molecular formula C26H48O4Si and a molecular weight of 452.75 g/mol. Its IUPAC name is methyl (5Z,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxyheptadeca-5,10-dienoate.
| Compound Name | methyl (5Z,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxyheptadeca-5,10-dienoate |
|---|---|
| PubChem CID | 12773789 |
| Molecular Formula | C26H48O4Si |
| Molecular Weight | 452.75 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | methyl (5Z,10E)-8-acetyl-12-[tert-butyl(dimethyl)silyl]oxyheptadeca-5,10-dienoate |
| SMILES | CCCCCC(/C=C/CC(C/C=C\CCCC(=O)OC)C(C)=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O4Si/c1-9-10-13-19-24(30-31(7,8)26(3,4)5)20-16-18-23(22(2)27)17-14-11-12-15-21-25(28)29-6/h11,14,16,20,23-24H,9-10,12-13,15,17-19,21H2,1-8H3/b14-11-,20-16+ |
| InChIKey | WDZLOEHKAPMDDH-XOLQDACBSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.75 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|