C16H16FNO2S — CID 12773880
1-[(4-fluorophenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol (PubChem CID 12773880) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol.
| Compound Name | 1-[(4-fluorophenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
|---|---|
| PubChem CID | 12773880 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 1-[(4-fluorophenyl)sulfanylmethyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol |
| SMILES | Oc1cc2c(cc1O)C(CSc1ccc(F)cc1)NCC2 |
| InChI | InChI=1S/C16H16FNO2S/c17-11-1-3-12(4-2-11)21-9-14-13-8-16(20)15(19)7-10(13)5-6-18-14/h1-4,7-8,14,18-20H,5-6,9H2 |
| InChIKey | KKWGVOIIOYBLLI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|