C15H17ClN2O3 — CID 12773910
1-(pyridin-4-yloxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride (PubChem CID 12773910) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is 1-(pyridin-4-yloxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride.
| Compound Name | 1-(pyridin-4-yloxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 12773910 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(pyridin-4-yloxymethyl)-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
| SMILES | Cl.Oc1cc2c(cc1O)C(COc1ccncc1)NCC2 |
| InChI | InChI=1S/C15H16N2O3.ClH/c18-14-7-10-1-6-17-13(12(10)8-15(14)19)9-20-11-2-4-16-5-3-11;/h2-5,7-8,13,17-19H,1,6,9H2;1H |
| InChIKey | GSKGKNAQGODOBJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|