C16H16Cl3NO3 — CID 12773915
1-[(3,4-dichlorophenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride (PubChem CID 12773915) has the molecular formula C16H16Cl3NO3 and a molecular weight of 376.67 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride.
| Compound Name | 1-[(3,4-dichlorophenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
|---|---|
| PubChem CID | 12773915 |
| Molecular Formula | C16H16Cl3NO3 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | 1-[(3,4-dichlorophenoxy)methyl]-1,2,3,4-tetrahydroisoquinoline-6,7-diol;hydrochloride |
| SMILES | Cl.Oc1cc2c(cc1O)C(COc1ccc(Cl)c(Cl)c1)NCC2 |
| InChI | InChI=1S/C16H15Cl2NO3.ClH/c17-12-2-1-10(6-13(12)18)22-8-14-11-7-16(21)15(20)5-9(11)3-4-19-14;/h1-2,5-7,14,19-21H,3-4,8H2;1H |
| InChIKey | RHCYUXKMSMBEBO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|