C24H24Cl2O4Si — CID 12774092
methyl 2-[[6,7-dichloro-1-oxo-2-phenyl-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate (PubChem CID 12774092) has the molecular formula C24H24Cl2O4Si and a molecular weight of 475.44 g/mol. Its IUPAC name is methyl 2-[[6,7-dichloro-1-oxo-2-phenyl-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate.
| Compound Name | methyl 2-[[6,7-dichloro-1-oxo-2-phenyl-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate |
|---|---|
| PubChem CID | 12774092 |
| Molecular Formula | C24H24Cl2O4Si |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | methyl 2-[[6,7-dichloro-1-oxo-2-phenyl-2-(3-trimethylsilylprop-2-ynyl)-3H-inden-5-yl]oxy]acetate |
| SMILES | COC(=O)COc1cc2c(c(Cl)c1Cl)C(=O)C(CC#C[Si](C)(C)C)(c1ccccc1)C2 |
| InChI | InChI=1S/C24H24Cl2O4Si/c1-29-19(27)15-30-18-13-16-14-24(11-8-12-31(2,3)4,17-9-6-5-7-10-17)23(28)20(16)22(26)21(18)25/h5-7,9-10,13H,11,14-15H2,1-4H3 |
| InChIKey | CGAKBDWKHSTGDR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|