C14H14F3N7O2 — CID 127742253
3-methyl-8-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 127742253) has the molecular formula C14H14F3N7O2 and a molecular weight of 369.31 g/mol. Its IUPAC name is 3-methyl-8-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-methyl-8-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 127742253 |
| Molecular Formula | C14H14F3N7O2 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-methyl-8-[5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CN1C(=O)NC2(CCN(c3cc(C(F)(F)F)nc4ncnn34)CC2)C1=O |
| InChI | InChI=1S/C14H14F3N7O2/c1-22-10(25)13(21-12(22)26)2-4-23(5-3-13)9-6-8(14(15,16)17)20-11-18-7-19-24(9)11/h6-7H,2-5H2,1H3,(H,21,26) |
| InChIKey | XLZYZGJHRNGSIT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|