C20H28F3N5O — CID 12774371
2-methyl-N-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]-5-(trifluoromethyl)-1,2,4-triazol-3-amine (PubChem CID 12774371) has the molecular formula C20H28F3N5O and a molecular weight of 411.47 g/mol. Its IUPAC name is 2-methyl-N-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]-5-(trifluoromethyl)-1,2,4-triazol-3-amine.
| Compound Name | 2-methyl-N-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]-5-(trifluoromethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 12774371 |
| Molecular Formula | C20H28F3N5O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 2-methyl-N-[4-[3-(piperidin-1-ylmethyl)phenoxy]butyl]-5-(trifluoromethyl)-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(C(F)(F)F)nc1NCCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C20H28F3N5O/c1-27-19(25-18(26-27)20(21,22)23)24-10-3-6-13-29-17-9-7-8-16(14-17)15-28-11-4-2-5-12-28/h7-9,14H,2-6,10-13,15H2,1H3,(H,24,25,26) |
| InChIKey | KUQYNVPAUDALCO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|