C21H28N4O2S — CID 1277465
[[2-(2,5-dioxopyrrolidin-1-yl)-1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]ethylidene]amino]thiourea (PubChem CID 1277465) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is [[2-(2,5-dioxopyrrolidin-1-yl)-1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]ethylidene]amino]thiourea.
| Compound Name | [[2-(2,5-dioxopyrrolidin-1-yl)-1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]ethylidene]amino]thiourea |
|---|---|
| PubChem CID | 1277465 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [[2-(2,5-dioxopyrrolidin-1-yl)-1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]ethylidene]amino]thiourea |
| SMILES | Cc1cc(C)c(C2(C)CC(C(CN3C(=O)CCC3=O)=NNC(N)=S)C2)c(C)c1 |
| InChI | InChI=1S/C21H28N4O2S/c1-12-7-13(2)19(14(3)8-12)21(4)9-15(10-21)16(23-24-20(22)28)11-25-17(26)5-6-18(25)27/h7-8,15H,5-6,9-11H2,1-4H3,(H3,22,24,28) |
| InChIKey | DJODANVEVHFTTN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|