About 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone
1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone (PubChem CID 1277476) has the molecular formula C20H29NOS
and a molecular weight of 331.53 g/mol. Its IUPAC name is 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone.
Molecular Properties
| Compound Name | 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone |
| PubChem CID | 1277476 |
| Molecular Formula | C20H29NOS |
| Molecular Weight | 331.53 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone |
| SMILES | Cc1cc(C)c(C2(C)CC(C(=O)CN3CCSCC3)C2)c(C)c1 |
| InChI | InChI=1S/C20H29NOS/c1-14-9-15(2)19(16(3)10-14)20(4)11-17(12-20)18(22)13-21-5-7-23-8-6-21/h9-10,17H,5-8,11-13H2,1-4H3 |
| InChIKey | YRXNBGXJUMKBHF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone?
The IUPAC name of 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone (CID 1277476) is 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone.
What is the SMILES notation for 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone?
The canonical SMILES for 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone is Cc1cc(C)c(C2(C)CC(C(=O)CN3CCSCC3)C2)c(C)c1.
What is the InChIKey of 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone?
The InChIKey is YRXNBGXJUMKBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29NOS/c1-14-9-15(2)19(16(3)10-14)20(4)11-17(12-20)18(22)13-21-5-7-23-8-6-21/h9-10,17H,5-8,11-13H2,1-4H3.
What are the key properties of 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone?
1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone has a molecular weight of 331.53 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-methyl-3-(2,4,6-trimethylphenyl)cyclobutyl]-2-thiomorpholin-4-ylethanone is sourced from PubChem (CID 1277476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).