C8H14O8 — CID 12775607
(2R,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 12775607) has the molecular formula C8H14O8 and a molecular weight of 238.19 g/mol. Its IUPAC name is (2R,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 12775607 |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | (2R,4S,5R,6R)-6-[(1R)-1,2-dihydroxyethyl]-2,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@@]1(O)C[C@H](O)[C@@H](O)[C@@H]([C@H](O)CO)O1 |
| InChI | InChI=1S/C8H14O8/c9-2-4(11)6-5(12)3(10)1-8(15,16-6)7(13)14/h3-6,9-12,15H,1-2H2,(H,13,14)/t3-,4+,5+,6+,8+/m0/s1 |
| InChIKey | NNLZBVFSCVTSLA-CAZBWKGRSA-N |
| XLogP | -3.38 |
| TPSA | 147.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |