C19H21FN2O3 — CID 127756286
1-(8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea (PubChem CID 127756286) has the molecular formula C19H21FN2O3 and a molecular weight of 344.39 g/mol. Its IUPAC name is 1-(8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea.
| Compound Name | 1-(8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
|---|---|
| PubChem CID | 127756286 |
| Molecular Formula | C19H21FN2O3 |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | 1-(8-fluoro-2,3,4,5-tetrahydro-1-benzoxepin-5-yl)-3-(4,5,6,7-tetrahydro-1-benzofuran-4-yl)urea |
| SMILES | O=C(NC1CCCOc2cc(F)ccc21)NC1CCCc2occc21 |
| InChI | InChI=1S/C19H21FN2O3/c20-12-6-7-13-16(4-2-9-24-18(13)11-12)22-19(23)21-15-3-1-5-17-14(15)8-10-25-17/h6-8,10-11,15-16H,1-5,9H2,(H2,21,22,23) |
| InChIKey | GALHSZDLTXHLRO-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |