C17H20N2O — CID 12776695
(1R,2S)-2-[[(E)-benzylideneamino]-methylamino]-1-phenylpropan-1-ol (PubChem CID 12776695) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is (1R,2S)-2-[[(E)-benzylideneamino]-methylamino]-1-phenylpropan-1-ol.
| Compound Name | (1R,2S)-2-[[(E)-benzylideneamino]-methylamino]-1-phenylpropan-1-ol |
|---|---|
| PubChem CID | 12776695 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | (1R,2S)-2-[[(E)-benzylideneamino]-methylamino]-1-phenylpropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccccc1)N(C)/N=C/c1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c1-14(17(20)16-11-7-4-8-12-16)19(2)18-13-15-9-5-3-6-10-15/h3-14,17,20H,1-2H3/b18-13+/t14-,17-/m0/s1 |
| InChIKey | GUOLECJKXFIGNE-WVISYZLISA-N |
| XLogP | 3.07 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|