diethyl 2,2-bis(but-3-enyl)propanedioate

C15H24O4 — CID 12776821

IUPACdiethyl 2,2-bis(but-3-enyl)propanedioate
SMILESC=CCCC(CCC=C)(C(=O)OCC)C(=O)OCC
InChIInChI=1S/C15H24O4/c1-5-9-11-15(12-10-6-2,13(16)18-7-3)14(17)19-8-4/h5-6H,1-2,7-12H2,3-4H3
InChIKeyIFZUKQOALLFBFW-UHFFFAOYSA-N
MW268.35 g/mol
LogP3.03
Rot. Bonds10

About diethyl 2,2-bis(but-3-enyl)propanedioate

diethyl 2,2-bis(but-3-enyl)propanedioate (PubChem CID 12776821) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is diethyl 2,2-bis(but-3-enyl)propanedioate.

Molecular Properties

Compound Namediethyl 2,2-bis(but-3-enyl)propanedioate
PubChem CID12776821
Molecular FormulaC15H24O4
Molecular Weight268.35 g/mol
Exact Mass268.17
IUPAC Namediethyl 2,2-bis(but-3-enyl)propanedioate
SMILESC=CCCC(CCC=C)(C(=O)OCC)C(=O)OCC
InChIInChI=1S/C15H24O4/c1-5-9-11-15(12-10-6-2,13(16)18-7-3)14(17)19-8-4/h5-6H,1-2,7-12H2,3-4H3
InChIKeyIFZUKQOALLFBFW-UHFFFAOYSA-N
XLogP3.03
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.35
LogP ≤ 53.03
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze diethyl 2,2-bis(but-3-enyl)propanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,2-bis(but-3-enyl)propanedioate?
The IUPAC name of diethyl 2,2-bis(but-3-enyl)propanedioate (CID 12776821) is diethyl 2,2-bis(but-3-enyl)propanedioate.
What is the SMILES notation for diethyl 2,2-bis(but-3-enyl)propanedioate?
The canonical SMILES for diethyl 2,2-bis(but-3-enyl)propanedioate is C=CCCC(CCC=C)(C(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2,2-bis(but-3-enyl)propanedioate?
The InChIKey is IFZUKQOALLFBFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O4/c1-5-9-11-15(12-10-6-2,13(16)18-7-3)14(17)19-8-4/h5-6H,1-2,7-12H2,3-4H3.
What are the key properties of diethyl 2,2-bis(but-3-enyl)propanedioate?
diethyl 2,2-bis(but-3-enyl)propanedioate has a molecular weight of 268.35 g/mol, XLogP of 3.03, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,2-bis(but-3-enyl)propanedioate is sourced from PubChem (CID 12776821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).