About 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole
2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole (PubChem CID 12776826) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole |
| PubChem CID | 12776826 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc2cc(C3=NCCO3)ccc2c1 |
| InChI | InChI=1S/C13H11NO/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13/h1-6,9H,7-8H2 |
| InChIKey | JBPBWSKDBJRSAU-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole (CID 12776826) is 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole is c1ccc2cc(C3=NCCO3)ccc2c1.
What is the InChIKey of 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole?
The InChIKey is JBPBWSKDBJRSAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-2-4-11-9-12(6-5-10(11)3-1)13-14-7-8-15-13/h1-6,9H,7-8H2.
What are the key properties of 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole?
2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole has a molecular weight of 197.24 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-2-yl-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 12776826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).