C18H21F3N4O3 — CID 127768392
1-(2,2,5,5-tetramethyloxolan-3-yl)-3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea (PubChem CID 127768392) has the molecular formula C18H21F3N4O3 and a molecular weight of 398.39 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)-3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)-3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea |
|---|---|
| PubChem CID | 127768392 |
| Molecular Formula | C18H21F3N4O3 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)-3-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea |
| SMILES | CC1(C)CC(NC(=O)Nc2ccc(-c3noc(C(F)(F)F)n3)cc2)C(C)(C)O1 |
| InChI | InChI=1S/C18H21F3N4O3/c1-16(2)9-12(17(3,4)28-16)23-15(26)22-11-7-5-10(6-8-11)13-24-14(27-25-13)18(19,20)21/h5-8,12H,9H2,1-4H3,(H2,22,23,26) |
| InChIKey | HROSJWRZAMLPGK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |