C19H26N4O2 — CID 127768446
1-(1-benzylpyrazol-4-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea (PubChem CID 127768446) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(1-benzylpyrazol-4-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea.
| Compound Name | 1-(1-benzylpyrazol-4-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea |
|---|---|
| PubChem CID | 127768446 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-(1-benzylpyrazol-4-yl)-3-(2,2,5,5-tetramethyloxolan-3-yl)urea |
| SMILES | CC1(C)CC(NC(=O)Nc2cnn(Cc3ccccc3)c2)C(C)(C)O1 |
| InChI | InChI=1S/C19H26N4O2/c1-18(2)10-16(19(3,4)25-18)22-17(24)21-15-11-20-23(13-15)12-14-8-6-5-7-9-14/h5-9,11,13,16H,10,12H2,1-4H3,(H2,21,22,24) |
| InChIKey | VPGUSVCFDHPCDH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |