C9H17F3N2O2S — CID 127770386
N-propan-2-yl-4-(trifluoromethyl)piperidine-1-sulfonamide (PubChem CID 127770386) has the molecular formula C9H17F3N2O2S and a molecular weight of 274.31 g/mol. Its IUPAC name is N-propan-2-yl-4-(trifluoromethyl)piperidine-1-sulfonamide.
| Compound Name | N-propan-2-yl-4-(trifluoromethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 127770386 |
| Molecular Formula | C9H17F3N2O2S |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-propan-2-yl-4-(trifluoromethyl)piperidine-1-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)N1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H17F3N2O2S/c1-7(2)13-17(15,16)14-5-3-8(4-6-14)9(10,11)12/h7-8,13H,3-6H2,1-2H3 |
| InChIKey | DPCALHNUWIHACW-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |